 |
Java Games: Flashcards, matching, concentration, and word search. |
 |
|
Organic Functional Groups
Match the condensed formula with the functional group or side chain it contains
|
| A | B |
|---|
| alcohol | CH3CH2CH2OH |
| ether | CH3CH2OCH3 |
| aldehyde | CH3CH2CH2CHO |
| ketone | CH3COCH3 |
| carboxylic acid | CH3CH2CH2CH2COOH |
| ester | CH3CH2COOCH3 |
| amine (2*) | CH3CH2NHCH3 |
| amide | CH3CONHCH2CH3 |
| alkyl halide (bromide) | CH3CHBrCH2CH2CH3 |
| methyl | CH3CH(CH3)CH2CH3 |
| ethyl | CH3CH2CH(CH2CH3)CH2CH3 |
| dimethyl | CH3CH2C(CH3)2CH2CH3 |
| alkyl halide (iodide) | CH2ICH2CH2CH3 |
| ethyl-methyl | CH3CH(CH3)CH2CH(CH2CH3)CH2CH3 |
| alkyl halide (fluoride) | CH3CH2CF2CH3 |
| alkene | CH3CHCHCH2CH3 |
| alkyne | CH3CCCH3 |
| diol | CH3CH(OH)CH2CH2CH2OH |
| diene | CH2CHCH2CH2CHCHCH3 |
| amine (1*) | NH2CH2CH2CH3 |
|
| |
